C27H36O3 — CID 67707002
methyl (8S,9S,13S,14S,17S)-17-(cyclohexanecarbonyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 67707002) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is methyl (8S,9S,13S,14S,17S)-17-(cyclohexanecarbonyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8S,9S,13S,14S,17S)-17-(cyclohexanecarbonyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 67707002 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | methyl (8S,9S,13S,14S,17S)-17-(cyclohexanecarbonyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)C3CCCCC3)CC[C@@H]12 |
| InChI | InChI=1S/C27H36O3/c1-27-15-14-21-20-10-9-19(26(29)30-2)16-18(20)8-11-22(21)23(27)12-13-24(27)25(28)17-6-4-3-5-7-17/h9-10,16-17,21-24H,3-8,11-15H2,1-2H3/t21-,22-,23+,24-,27+/m1/s1 |
| InChIKey | ZWHHKIXQZRTNQT-CXBVJKJKSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |