C25H29NO3 — CID 137370137
(8S,9S,13S,14S,17S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 137370137) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,13S,14S,17S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 137370137 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (8S,9S,13S,14S,17S)-17-(5-methoxy-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | COc1cncc([C@H]2CC[C@H]3[C@@H]4CCc5cc(C(=O)O)ccc5[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C25H29NO3/c1-25-10-9-20-19-5-4-16(24(27)28)11-15(19)3-6-21(20)23(25)8-7-22(25)17-12-18(29-2)14-26-13-17/h4-5,11-14,20-23H,3,6-10H2,1-2H3,(H,27,28)/t20-,21-,22-,23+,25-/m1/s1 |
| InChIKey | XXKCQXSAUVTDEX-COWNTTACSA-N |
| XLogP | 5.43 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |