C31H41N3O3 — CID 137385224
tert-butyl 3-[methyl-(13-methyl-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonyl)amino]propanoate (PubChem CID 137385224) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is tert-butyl 3-[methyl-(13-methyl-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonyl)amino]propanoate.
| Compound Name | tert-butyl 3-[methyl-(13-methyl-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 137385224 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | tert-butyl 3-[methyl-(13-methyl-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonyl)amino]propanoate |
| SMILES | CN(CCC(=O)OC(C)(C)C)C(=O)c1ccc2c(c1)CCC1C2CCC2(C)C(c3cncnc3)CCC12 |
| InChI | InChI=1S/C31H41N3O3/c1-30(2,3)37-28(35)13-15-34(5)29(36)21-7-8-23-20(16-21)6-9-25-24(23)12-14-31(4)26(10-11-27(25)31)22-17-32-19-33-18-22/h7-8,16-19,24-27H,6,9-15H2,1-5H3 |
| InChIKey | DFGRHMQTXCNNHK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |