C27H33N3O2 — CID 137382436
N,13-dimethyl-N-(3-oxopropyl)-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 137382436) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N,13-dimethyl-N-(3-oxopropyl)-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | N,13-dimethyl-N-(3-oxopropyl)-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 137382436 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N,13-dimethyl-N-(3-oxopropyl)-17-pyrimidin-5-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CN(CCC=O)C(=O)c1ccc2c(c1)CCC1C2CCC2(C)C(c3cncnc3)CCC12 |
| InChI | InChI=1S/C27H33N3O2/c1-27-11-10-22-21-6-5-19(26(32)30(2)12-3-13-31)14-18(21)4-7-23(22)25(27)9-8-24(27)20-15-28-17-29-16-20/h5-6,13-17,22-25H,3-4,7-12H2,1-2H3 |
| InChIKey | YDDZGHQETDUMGS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|