C24H36BrNO — CID 134871052
(10R,13S,17S)-3-bromo-N-tert-butyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 134871052) has the molecular formula C24H36BrNO and a molecular weight of 434.46 g/mol. Its IUPAC name is (10R,13S,17S)-3-bromo-N-tert-butyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (10R,13S,17S)-3-bromo-N-tert-butyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 134871052 |
| Molecular Formula | C24H36BrNO |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (10R,13S,17S)-3-bromo-N-tert-butyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1CCC2C3CC=C4C=C(Br)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H36BrNO/c1-22(2,3)26-21(27)20-9-8-18-17-7-6-15-14-16(25)10-12-23(15,4)19(17)11-13-24(18,20)5/h6,14,17-20H,7-13H2,1-5H3,(H,26,27)/t17?,18?,19?,20-,23+,24+/m1/s1 |
| InChIKey | WYQFEYHEDRLWEN-KWJNIKROSA-N |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |