C27H39NO3 — CID 67841729
methyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-methylbut-3-en-2-ylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 67841729) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is methyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-methylbut-3-en-2-ylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-methylbut-3-en-2-ylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 67841729 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | methyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-methylbut-3-en-2-ylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | C=CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(C(=O)OC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H39NO3/c1-7-25(2,3)28-23(29)22-11-10-20-19-9-8-18-16-17(24(30)31-6)12-14-26(18,4)21(19)13-15-27(20,22)5/h7-8,16,19-22H,1,9-15H2,2-6H3,(H,28,29)/t19-,20-,21-,22+,26-,27-/m0/s1 |
| InChIKey | PWEGTZXEQWTENB-SATFXIDDSA-N |
| XLogP | 5.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|