C16H14F3NO5 — CID 54241457
1-cyclopropyl-2-(ethoxymethylidene)-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione (PubChem CID 54241457) has the molecular formula C16H14F3NO5 and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-cyclopropyl-2-(ethoxymethylidene)-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione.
| Compound Name | 1-cyclopropyl-2-(ethoxymethylidene)-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 54241457 |
| Molecular Formula | C16H14F3NO5 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-cyclopropyl-2-(ethoxymethylidene)-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione |
| SMILES | CCOC=C(C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)C1CC1 |
| InChI | InChI=1S/C16H14F3NO5/c1-2-25-8-12(14(21)9-3-4-9)15(22)11-6-5-10(16(17,18)19)7-13(11)20(23)24/h5-9H,2-4H2,1H3 |
| InChIKey | QQHNGPPGGHYQGC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|