C16H19NO4 — CID 54242647
ethyl 3-[2-[2-(prop-2-enylamino)phenyl]acetyl]oxyprop-2-enoate (PubChem CID 54242647) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 3-[2-[2-(prop-2-enylamino)phenyl]acetyl]oxyprop-2-enoate.
| Compound Name | ethyl 3-[2-[2-(prop-2-enylamino)phenyl]acetyl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 54242647 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 3-[2-[2-(prop-2-enylamino)phenyl]acetyl]oxyprop-2-enoate |
| SMILES | C=CCNc1ccccc1CC(=O)OC=CC(=O)OCC |
| InChI | InChI=1S/C16H19NO4/c1-3-10-17-14-8-6-5-7-13(14)12-16(19)21-11-9-15(18)20-4-2/h3,5-9,11,17H,1,4,10,12H2,2H3 |
| InChIKey | QRBZPVZBRDBPJF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|