C10H8BrN5O2 — CID 54242948
6-[(5-bromofuran-2-yl)methoxy]-7H-purin-2-amine (PubChem CID 54242948) has the molecular formula C10H8BrN5O2 and a molecular weight of 310.11 g/mol. Its IUPAC name is 6-[(5-bromofuran-2-yl)methoxy]-7H-purin-2-amine.
| Compound Name | 6-[(5-bromofuran-2-yl)methoxy]-7H-purin-2-amine |
|---|---|
| PubChem CID | 54242948 |
| Molecular Formula | C10H8BrN5O2 |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 6-[(5-bromofuran-2-yl)methoxy]-7H-purin-2-amine |
| SMILES | Nc1nc(OCc2ccc(Br)o2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H8BrN5O2/c11-6-2-1-5(18-6)3-17-9-7-8(14-4-13-7)15-10(12)16-9/h1-2,4H,3H2,(H3,12,13,14,15,16) |
| InChIKey | QRGXGNRKJCOFSM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |