C11H9N5O4 — CID 54295938
5-[(2-amino-7H-purin-6-yl)oxymethyl]furan-2-carboxylic acid (PubChem CID 54295938) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-[(2-amino-7H-purin-6-yl)oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-amino-7H-purin-6-yl)oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 54295938 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-[(2-amino-7H-purin-6-yl)oxymethyl]furan-2-carboxylic acid |
| SMILES | Nc1nc(OCc2ccc(C(=O)O)o2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H9N5O4/c12-11-15-8-7(13-4-14-8)9(16-11)19-3-5-1-2-6(20-5)10(17)18/h1-2,4H,3H2,(H,17,18)(H3,12,13,14,15,16) |
| InChIKey | SAUPDYLGNLZJNN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |