C24H38O7 — CID 54246492
[2-ethyl-2-[1-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)butan-2-yl]oxypentyl] 2-methylprop-2-enoate (PubChem CID 54246492) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is [2-ethyl-2-[1-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)butan-2-yl]oxypentyl] 2-methylprop-2-enoate.
| Compound Name | [2-ethyl-2-[1-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)butan-2-yl]oxypentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54246492 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [2-ethyl-2-[1-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)butan-2-yl]oxypentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)(CCC)OC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C24H38O7/c1-10-13-23(11-2,14-28-20(25)17(4)5)31-24(12-3,15-29-21(26)18(6)7)16-30-22(27)19(8)9/h4,6,8,10-16H2,1-3,5,7,9H3 |
| InChIKey | QTQCVIKBYNBKKA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|