C12H10FNO3 — CID 54246627
2-(2-fluorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 54246627) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 54246627 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | O=C(Cc1ccccc1F)NC1=CC(=O)OC1 |
| InChI | InChI=1S/C12H10FNO3/c13-10-4-2-1-3-8(10)5-11(15)14-9-6-12(16)17-7-9/h1-4,6H,5,7H2,(H,14,15) |
| InChIKey | QTSIZFPLZKHZHC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |