About 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine
1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine (PubChem CID 54246704) has the molecular formula C12H30N2O4
and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine |
| PubChem CID | 54246704 |
| Molecular Formula | C12H30N2O4 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine |
| SMILES | CCC(O)COC.CNCCN.COCC1CO1 |
| InChI | InChI=1S/C5H12O2.C4H8O2.C3H10N2/c1-3-5(6)4-7-2;1-5-2-4-3-6-4;1-5-3-2-4/h5-6H,3-4H2,1-2H3;4H,2-3H2,1H3;5H,2-4H2,1H3 |
| InChIKey | QTTNSRWUOXIUJM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine?
The IUPAC name of 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine (CID 54246704) is 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine.
What is the SMILES notation for 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine?
The canonical SMILES for 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine is CCC(O)COC.CNCCN.COCC1CO1.
What is the InChIKey of 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine?
The InChIKey is QTTNSRWUOXIUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H8O2.C3H10N2/c1-3-5(6)4-7-2;1-5-2-4-3-6-4;1-5-3-2-4/h5-6H,3-4H2,1-2H3;4H,2-3H2,1H3;5H,2-4H2,1H3.
What are the key properties of 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine?
1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine has a molecular weight of 266.38 g/mol, XLogP of -0.40, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxybutan-2-ol;2-(methoxymethyl)oxirane;N'-methylethane-1,2-diamine is sourced from PubChem (CID 54246704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).