C10H5Cl2F3S — CID 54252533
6,8-dichloro-2-(trifluoromethyl)-2H-thiochromene (PubChem CID 54252533) has the molecular formula C10H5Cl2F3S and a molecular weight of 285.12 g/mol. Its IUPAC name is 6,8-dichloro-2-(trifluoromethyl)-2H-thiochromene.
| Compound Name | 6,8-dichloro-2-(trifluoromethyl)-2H-thiochromene |
|---|---|
| PubChem CID | 54252533 |
| Molecular Formula | C10H5Cl2F3S |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 6,8-dichloro-2-(trifluoromethyl)-2H-thiochromene |
| SMILES | FC(F)(F)C1C=Cc2cc(Cl)cc(Cl)c2S1 |
| InChI | InChI=1S/C10H5Cl2F3S/c11-6-3-5-1-2-8(10(13,14)15)16-9(5)7(12)4-6/h1-4,8H |
| InChIKey | QXTUUMAYIDCEAY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |