C28H25N3O3S2 — CID 54252986
2-[[5-(6,13-diethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidene-1H-pyrimidin-3-yl]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 54252986) has the molecular formula C28H25N3O3S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 2-[[5-(6,13-diethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidene-1H-pyrimidin-3-yl]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[5-(6,13-diethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidene-1H-pyrimidin-3-yl]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54252986 |
| Molecular Formula | C28H25N3O3S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[[5-(6,13-diethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2-oxo-4-sulfanylidene-1H-pyrimidin-3-yl]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCc1ccc2c(c1)C=Cc1cc(CC)ccc1C2c1c[nH]c(=O)n(Cc2nc(C(=O)O)cs2)c1=S |
| InChI | InChI=1S/C28H25N3O3S2/c1-3-16-5-9-20-18(11-16)7-8-19-12-17(4-2)6-10-21(19)25(20)22-13-29-28(34)31(26(22)35)14-24-30-23(15-36-24)27(32)33/h5-13,15,25H,3-4,14H2,1-2H3,(H,29,34)(H,32,33) |
| InChIKey | QYBIPDZOIVXCIF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|