C26H21N3O4S — CID 22117279
2-[[5-(6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 22117279) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[[5-(6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[5-(6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22117279 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[[5-(6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1ccc2c(c1)C=Cc1cc(C)ccc1C2c1cn(Cc2nc(C(=O)O)cs2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H21N3O4S/c1-14-3-7-18-16(9-14)5-6-17-10-15(2)4-8-19(17)23(18)20-11-29(26(33)28-24(20)30)12-22-27-21(13-34-22)25(31)32/h3-11,13,23H,12H2,1-2H3,(H,31,32)(H,28,30,33) |
| InChIKey | AVNMDEIVCQABQW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|