C14H15NO3S — CID 82054904
2-[3-(3-methylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 82054904) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[3-(3-methylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(3-methylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82054904 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-[3-(3-methylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cccc(OCCCc2nc(C(=O)O)cs2)c1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-4-2-5-11(8-10)18-7-3-6-13-15-12(9-19-13)14(16)17/h2,4-5,8-9H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | WADNDOLZKWDREB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|