C16H17N3O3S — CID 39197754
2-[2-[3-(3-methylphenoxy)propyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]acetic acid (PubChem CID 39197754) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[2-[3-(3-methylphenoxy)propyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]acetic acid.
| Compound Name | 2-[2-[3-(3-methylphenoxy)propyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]acetic acid |
|---|---|
| PubChem CID | 39197754 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[2-[3-(3-methylphenoxy)propyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]acetic acid |
| SMILES | Cc1cccc(OCCCc2nn3cc(CC(=O)O)nc3s2)c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11-4-2-5-13(8-11)22-7-3-6-14-18-19-10-12(9-15(20)21)17-16(19)23-14/h2,4-5,8,10H,3,6-7,9H2,1H3,(H,20,21) |
| InChIKey | CSXRSNRMOXCIRU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|