C25H27NO9 — CID 54254157
ethyl 6-(4-ethoxy-4-oxobut-2-enoxy)-1-(4-ethoxy-4-oxobut-2-enyl)-4,7-dioxocyclohepta[b]pyridine-2-carboxylate (PubChem CID 54254157) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is ethyl 6-(4-ethoxy-4-oxobut-2-enoxy)-1-(4-ethoxy-4-oxobut-2-enyl)-4,7-dioxocyclohepta[b]pyridine-2-carboxylate.
| Compound Name | ethyl 6-(4-ethoxy-4-oxobut-2-enoxy)-1-(4-ethoxy-4-oxobut-2-enyl)-4,7-dioxocyclohepta[b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 54254157 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | ethyl 6-(4-ethoxy-4-oxobut-2-enoxy)-1-(4-ethoxy-4-oxobut-2-enyl)-4,7-dioxocyclohepta[b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)C=CCOc1cc2c(=O)cc(C(=O)OCC)n(CC=CC(=O)OCC)c2ccc1=O |
| InChI | InChI=1S/C25H27NO9/c1-4-32-23(29)9-7-13-26-18-11-12-20(27)22(35-14-8-10-24(30)33-5-2)15-17(18)21(28)16-19(26)25(31)34-6-3/h7-12,15-16H,4-6,13-14H2,1-3H3 |
| InChIKey | QYVLNHKKJQEXDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 127.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|