C18H32O4P2 — CID 54254204
1,2-bis(dipropylphosphoryloxy)benzene (PubChem CID 54254204) has the molecular formula C18H32O4P2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1,2-bis(dipropylphosphoryloxy)benzene.
| Compound Name | 1,2-bis(dipropylphosphoryloxy)benzene |
|---|---|
| PubChem CID | 54254204 |
| Molecular Formula | C18H32O4P2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1,2-bis(dipropylphosphoryloxy)benzene |
| SMILES | CCCP(=O)(CCC)Oc1ccccc1OP(=O)(CCC)CCC |
| InChI | InChI=1S/C18H32O4P2/c1-5-13-23(19,14-6-2)21-17-11-9-10-12-18(17)22-24(20,15-7-3)16-8-4/h9-12H,5-8,13-16H2,1-4H3 |
| InChIKey | QYWFVCGALDKHLF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|