C21H21N3O3 — CID 54255665
7-amino-3-[(3-ethoxy-2-methoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 54255665) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 7-amino-3-[(3-ethoxy-2-methoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | 7-amino-3-[(3-ethoxy-2-methoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 54255665 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 7-amino-3-[(3-ethoxy-2-methoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | CCOc1cccc(C=C2CCn3c2nc2ccc(N)cc2c3=O)c1OC |
| InChI | InChI=1S/C21H21N3O3/c1-3-27-18-6-4-5-13(19(18)26-2)11-14-9-10-24-20(14)23-17-8-7-15(22)12-16(17)21(24)25/h4-8,11-12H,3,9-10,22H2,1-2H3 |
| InChIKey | QZWVIYSKOJYWDJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|