C15H21N3O4S — CID 54256681
(2S)-2-[(carbamothioylamino)-phenylmethoxycarbonylamino]hexanoic acid (PubChem CID 54256681) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2S)-2-[(carbamothioylamino)-phenylmethoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[(carbamothioylamino)-phenylmethoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 54256681 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2S)-2-[(carbamothioylamino)-phenylmethoxycarbonylamino]hexanoic acid |
| SMILES | CCCC[C@@H](C(=O)O)N(NC(N)=S)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-2-3-9-12(13(19)20)18(17-14(16)23)15(21)22-10-11-7-5-4-6-8-11/h4-8,12H,2-3,9-10H2,1H3,(H,19,20)(H3,16,17,23)/t12-/m0/s1 |
| InChIKey | RAOFKZAYHKOWBO-LBPRGKRZSA-N |
| XLogP | 2.02 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|