C21H24F4 — CID 54257205
1,3,4-trifluoro-5-(2-fluoro-4-octylphenyl)-2-methylbenzene (PubChem CID 54257205) has the molecular formula C21H24F4 and a molecular weight of 352.42 g/mol. Its IUPAC name is 1,3,4-trifluoro-5-(2-fluoro-4-octylphenyl)-2-methylbenzene.
| Compound Name | 1,3,4-trifluoro-5-(2-fluoro-4-octylphenyl)-2-methylbenzene |
|---|---|
| PubChem CID | 54257205 |
| Molecular Formula | C21H24F4 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1,3,4-trifluoro-5-(2-fluoro-4-octylphenyl)-2-methylbenzene |
| SMILES | CCCCCCCCc1ccc(-c2cc(F)c(C)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C21H24F4/c1-3-4-5-6-7-8-9-15-10-11-16(19(23)12-15)17-13-18(22)14(2)20(24)21(17)25/h10-13H,3-9H2,1-2H3 |
| InChIKey | RAXMRCJYHPAEIQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|