C13H10O2 — CID 54257700
1,3-dihydrobenzo[c]chromen-2-one (PubChem CID 54257700) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,3-dihydrobenzo[c]chromen-2-one.
| Compound Name | 1,3-dihydrobenzo[c]chromen-2-one |
|---|---|
| PubChem CID | 54257700 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1,3-dihydrobenzo[c]chromen-2-one |
| SMILES | O=C1CC=C2OC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H10O2/c14-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-15-13/h1-4,6,8H,5,7H2 |
| InChIKey | RBGFEJHGCCMLSN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |