C16H17N3O2 — CID 54258111
2-[5-(methoxymethoxy)-1,3-dimethylpyrazol-4-yl]quinoline (PubChem CID 54258111) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[5-(methoxymethoxy)-1,3-dimethylpyrazol-4-yl]quinoline.
| Compound Name | 2-[5-(methoxymethoxy)-1,3-dimethylpyrazol-4-yl]quinoline |
|---|---|
| PubChem CID | 54258111 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[5-(methoxymethoxy)-1,3-dimethylpyrazol-4-yl]quinoline |
| SMILES | COCOc1c(-c2ccc3ccccc3n2)c(C)nn1C |
| InChI | InChI=1S/C16H17N3O2/c1-11-15(16(19(2)18-11)21-10-20-3)14-9-8-12-6-4-5-7-13(12)17-14/h4-9H,10H2,1-3H3 |
| InChIKey | RBMQLJPMTHEFOG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|