oct-4-ene-4-sulfonic acid

C8H16O3S — CID 54258597

IUPACoct-4-ene-4-sulfonic acid
SMILESCCCC=C(CCC)S(=O)(=O)O
InChIInChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11)
InChIKeyRBVVZKPPKQRZJK-UHFFFAOYSA-N
MW192.28 g/mol
LogP2.36
Rot. Bonds5

About oct-4-ene-4-sulfonic acid

oct-4-ene-4-sulfonic acid (PubChem CID 54258597) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is oct-4-ene-4-sulfonic acid.

Molecular Properties

Compound Nameoct-4-ene-4-sulfonic acid
PubChem CID54258597
Molecular FormulaC8H16O3S
Molecular Weight192.28 g/mol
Exact Mass192.08
IUPAC Nameoct-4-ene-4-sulfonic acid
SMILESCCCC=C(CCC)S(=O)(=O)O
InChIInChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11)
InChIKeyRBVVZKPPKQRZJK-UHFFFAOYSA-N
XLogP2.36
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.28
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze oct-4-ene-4-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oct-4-ene-4-sulfonic acid?
The IUPAC name of oct-4-ene-4-sulfonic acid (CID 54258597) is oct-4-ene-4-sulfonic acid.
What is the SMILES notation for oct-4-ene-4-sulfonic acid?
The canonical SMILES for oct-4-ene-4-sulfonic acid is CCCC=C(CCC)S(=O)(=O)O.
What is the InChIKey of oct-4-ene-4-sulfonic acid?
The InChIKey is RBVVZKPPKQRZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S/c1-3-5-7-8(6-4-2)12(9,10)11/h7H,3-6H2,1-2H3,(H,9,10,11).
What are the key properties of oct-4-ene-4-sulfonic acid?
oct-4-ene-4-sulfonic acid has a molecular weight of 192.28 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-4-ene-4-sulfonic acid is sourced from PubChem (CID 54258597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).