C30H31ClN2O2 — CID 54258925
(2R)-N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-methoxy-2-phenylacetamide (PubChem CID 54258925) has the molecular formula C30H31ClN2O2 and a molecular weight of 487.04 g/mol. Its IUPAC name is (2R)-N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-methoxy-2-phenylacetamide.
| Compound Name | (2R)-N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 54258925 |
| Molecular Formula | C30H31ClN2O2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (2R)-N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H31ClN2O2/c1-35-28(20-7-3-2-4-8-20)29(34)32-22-13-15-33(16-14-22)19-30-18-25(23-9-5-6-10-26(23)30)24-12-11-21(31)17-27(24)30/h2-12,17,22,25,28H,13-16,18-19H2,1H3,(H,32,34)/t25?,28-,30?/m1/s1 |
| InChIKey | RCBVOHFLEAARES-OTDMGWBDSA-N |
| XLogP | 5.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |