C20H22ClN3 — CID 139617007
4-[[(1S,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperazin-1-amine (PubChem CID 139617007) has the molecular formula C20H22ClN3 and a molecular weight of 339.87 g/mol. Its IUPAC name is 4-[[(1S,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperazin-1-amine.
| Compound Name | 4-[[(1S,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperazin-1-amine |
|---|---|
| PubChem CID | 139617007 |
| Molecular Formula | C20H22ClN3 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[[(1S,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperazin-1-amine |
| SMILES | NN1CCN(C[C@@]23C[C@@H](c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C20H22ClN3/c21-14-5-6-16-17-12-20(19(16)11-14,18-4-2-1-3-15(17)18)13-23-7-9-24(22)10-8-23/h1-6,11,17H,7-10,12-13,22H2/t17-,20-/m0/s1 |
| InChIKey | XCUGLMLPOVSXBH-PXNSSMCTSA-N |
| XLogP | 2.97 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|