C12H20O2 — CID 542594
7-(methoxymethoxy)-1,2,3,4,4a,5,6,7-octahydronaphthalene (PubChem CID 542594) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 7-(methoxymethoxy)-1,2,3,4,4a,5,6,7-octahydronaphthalene.
| Compound Name | 7-(methoxymethoxy)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
|---|---|
| PubChem CID | 542594 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 7-(methoxymethoxy)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES | COCOC1C=C2CCCCC2CC1 |
| InChI | InChI=1S/C12H20O2/c1-13-9-14-12-7-6-10-4-2-3-5-11(10)8-12/h8,10,12H,2-7,9H2,1H3 |
| InChIKey | FRTLEMKMFNSQPP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|