C15H26O2 — CID 59026964
(2R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-methoxy-3,6-dihydro-2H-pyran (PubChem CID 59026964) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-methoxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-methoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 59026964 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-methoxy-3,6-dihydro-2H-pyran |
| SMILES | COC1C=CC[C@@H](C[C@@H](C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)11-14-9-6-10-15(16-4)17-14/h6-7,10,13-15H,5,8-9,11H2,1-4H3/t13-,14-,15?/m0/s1 |
| InChIKey | HVKJBQJBFSMFMP-ZYOSVBKOSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|