C20H34O3 — CID 135050594
2-[(Z)-6-[(3R,6R)-6-methoxy-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane (PubChem CID 135050594) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-[(Z)-6-[(3R,6R)-6-methoxy-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane.
| Compound Name | 2-[(Z)-6-[(3R,6R)-6-methoxy-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane |
|---|---|
| PubChem CID | 135050594 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-[(Z)-6-[(3R,6R)-6-methoxy-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane |
| SMILES | CO[C@@H]1CC[C@@H](C)C(C)=C1CC/C=C\CCOC1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-16-12-13-19(21-3)18(17(16)2)10-6-4-5-8-14-22-20-11-7-9-15-23-20/h4-5,16,19-20H,6-15H2,1-3H3/b5-4-/t16-,19-,20?/m1/s1 |
| InChIKey | RECJSVWPFUEBCR-PUXYIHPUSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|