C21H38O4 — CID 46855104
(2R,3S,4R,6R)-2-ethenyl-3-ethyl-4-(methoxymethoxy)-6-[(E,2S,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]oxane (PubChem CID 46855104) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2R,3S,4R,6R)-2-ethenyl-3-ethyl-4-(methoxymethoxy)-6-[(E,2S,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]oxane.
| Compound Name | (2R,3S,4R,6R)-2-ethenyl-3-ethyl-4-(methoxymethoxy)-6-[(E,2S,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]oxane |
|---|---|
| PubChem CID | 46855104 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (2R,3S,4R,6R)-2-ethenyl-3-ethyl-4-(methoxymethoxy)-6-[(E,2S,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]oxane |
| SMILES | C=C[C@H]1O[C@@H]([C@H](C)[C@H](OC)[C@@H](C)C/C=C/C)C[C@@H](OCOC)[C@@H]1CC |
| InChI | InChI=1S/C21H38O4/c1-8-11-12-15(4)21(23-7)16(5)19-13-20(24-14-22-6)17(9-2)18(10-3)25-19/h8,10-11,15-21H,3,9,12-14H2,1-2,4-7H3/b11-8+/t15-,16-,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | AZQXIGBPGYQCPT-YFFJAFONSA-N |
| XLogP | 4.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|