C18H34O4 — CID 134974810
(E)-3-methoxy-6-(6-methoxy-3,6-dimethyloxan-2-yl)-2,4-dimethylhept-5-en-1-ol (PubChem CID 134974810) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (E)-3-methoxy-6-(6-methoxy-3,6-dimethyloxan-2-yl)-2,4-dimethylhept-5-en-1-ol.
| Compound Name | (E)-3-methoxy-6-(6-methoxy-3,6-dimethyloxan-2-yl)-2,4-dimethylhept-5-en-1-ol |
|---|---|
| PubChem CID | 134974810 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (E)-3-methoxy-6-(6-methoxy-3,6-dimethyloxan-2-yl)-2,4-dimethylhept-5-en-1-ol |
| SMILES | COC(C(C)/C=C(\C)C1OC(C)(OC)CCC1C)C(C)CO |
| InChI | InChI=1S/C18H34O4/c1-12-8-9-18(5,21-7)22-17(12)14(3)10-13(2)16(20-6)15(4)11-19/h10,12-13,15-17,19H,8-9,11H2,1-7H3/b14-10+ |
| InChIKey | YHNBYMKIWZHJCI-GXDHUFHOSA-N |
| XLogP | 3.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|