C25H42O5 — CID 134982262
(2S,5S,7R,8Z,10Z,12E)-5-(1-ethoxyethoxy)-2-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]tetradeca-8,10,12-trien-7-ol (PubChem CID 134982262) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (2S,5S,7R,8Z,10Z,12E)-5-(1-ethoxyethoxy)-2-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]tetradeca-8,10,12-trien-7-ol.
| Compound Name | (2S,5S,7R,8Z,10Z,12E)-5-(1-ethoxyethoxy)-2-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]tetradeca-8,10,12-trien-7-ol |
|---|---|
| PubChem CID | 134982262 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (2S,5S,7R,8Z,10Z,12E)-5-(1-ethoxyethoxy)-2-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]tetradeca-8,10,12-trien-7-ol |
| SMILES | C/C=C/C=C\C=C/[C@H](O)C[C@H](CC[C@H](C)C1O[C@@H](OC)C=C[C@@H]1C)OC(C)OCC |
| InChI | InChI=1S/C25H42O5/c1-7-9-10-11-12-13-22(26)18-23(29-21(5)28-8-2)16-14-19(3)25-20(4)15-17-24(27-6)30-25/h7,9-13,15,17,19-26H,8,14,16,18H2,1-6H3/b9-7+,11-10-,13-12-/t19-,20-,21?,22-,23-,24+,25?/m0/s1 |
| InChIKey | DUHSDWFVLYGOMJ-NTVWZULSSA-N |
| XLogP | 5.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|