C23H44O4 — CID 166444574
(6E,8E,10R)-1,1-diethoxy-5-(methoxymethoxy)-10-methylhexadeca-6,8-diene (PubChem CID 166444574) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is (6E,8E,10R)-1,1-diethoxy-5-(methoxymethoxy)-10-methylhexadeca-6,8-diene.
| Compound Name | (6E,8E,10R)-1,1-diethoxy-5-(methoxymethoxy)-10-methylhexadeca-6,8-diene |
|---|---|
| PubChem CID | 166444574 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | (6E,8E,10R)-1,1-diethoxy-5-(methoxymethoxy)-10-methylhexadeca-6,8-diene |
| SMILES | CCCCCC[C@@H](C)/C=C/C=C/C(CCCC(OCC)OCC)OCOC |
| InChI | InChI=1S/C23H44O4/c1-6-9-10-11-15-21(4)16-12-13-17-22(27-20-24-5)18-14-19-23(25-7-2)26-8-3/h12-13,16-17,21-23H,6-11,14-15,18-20H2,1-5H3/b16-12+,17-13+/t21-,22?/m1/s1 |
| InChIKey | BQWBXDYVFDXEFJ-ALFATUPSSA-N |
| XLogP | 6.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|