C23H46O4 — CID 151054589
4-methoxy-7-(triethoxymethyl)pentadec-2-ene (PubChem CID 151054589) has the molecular formula C23H46O4 and a molecular weight of 386.62 g/mol. Its IUPAC name is 4-methoxy-7-(triethoxymethyl)pentadec-2-ene.
| Compound Name | 4-methoxy-7-(triethoxymethyl)pentadec-2-ene |
|---|---|
| PubChem CID | 151054589 |
| Molecular Formula | C23H46O4 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 4-methoxy-7-(triethoxymethyl)pentadec-2-ene |
| SMILES | CC=CC(CCC(CCCCCCCC)C(OCC)(OCC)OCC)OC |
| InChI | InChI=1S/C23H46O4/c1-7-12-13-14-15-16-18-21(19-20-22(24-6)17-8-2)23(25-9-3,26-10-4)27-11-5/h8,17,21-22H,7,9-16,18-20H2,1-6H3 |
| InChIKey | MEVNITRCNFOOLJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|