C23H42O5 — CID 135015378
[(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-9-methoxy-5-(methoxymethoxy)-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate (PubChem CID 135015378) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-9-methoxy-5-(methoxymethoxy)-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate.
| Compound Name | [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-9-methoxy-5-(methoxymethoxy)-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate |
|---|---|
| PubChem CID | 135015378 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-9-methoxy-5-(methoxymethoxy)-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate |
| SMILES | CC=C[C@@H](CC)[C@@H](C[C@@H](OC(C)=O)[C@H](C)[C@H](OC)[C@@H](C)C/C=C/C)OCOC |
| InChI | InChI=1S/C23H42O5/c1-9-12-14-17(4)23(26-8)18(5)21(28-19(6)24)15-22(27-16-25-7)20(11-3)13-10-2/h9-10,12-13,17-18,20-23H,11,14-16H2,1-8H3/b12-9+,13-10?/t17-,18-,20+,21+,22+,23+/m0/s1 |
| InChIKey | AVIHLTHTPOOPFW-JUEBNFABSA-N |
| XLogP | 5.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|