C21H38O4 — CID 135015494
[(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-5-hydroxy-9-methoxy-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate (PubChem CID 135015494) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-5-hydroxy-9-methoxy-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate.
| Compound Name | [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-5-hydroxy-9-methoxy-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate |
|---|---|
| PubChem CID | 135015494 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | [(4R,5R,7R,8S,9R,10S,12E)-4-ethyl-5-hydroxy-9-methoxy-8,10-dimethyltetradeca-2,12-dien-7-yl] acetate |
| SMILES | CC=C[C@@H](CC)[C@H](O)C[C@@H](OC(C)=O)[C@H](C)[C@H](OC)[C@@H](C)C/C=C/C |
| InChI | InChI=1S/C21H38O4/c1-8-11-13-15(4)21(24-7)16(5)20(25-17(6)22)14-19(23)18(10-3)12-9-2/h8-9,11-12,15-16,18-21,23H,10,13-14H2,1-7H3/b11-8+,12-9?/t15-,16-,18+,19+,20+,21+/m0/s1 |
| InChIKey | ROFUMKQZLGYLLL-QWYGZVDGSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|