C26H50O5 — CID 142528983
(10,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl) 2-methylpropanoate (PubChem CID 142528983) has the molecular formula C26H50O5 and a molecular weight of 442.68 g/mol. Its IUPAC name is (10,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl) 2-methylpropanoate.
| Compound Name | (10,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 142528983 |
| Molecular Formula | C26H50O5 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | (10,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl) 2-methylpropanoate |
| SMILES | C=CC(C)CC(C)C(CCC(C)C(CC(CC)OCCC)(OC)OC)OC(=O)C(C)C |
| InChI | InChI=1S/C26H50O5/c1-11-16-30-23(13-3)18-26(28-9,29-10)22(8)14-15-24(31-25(27)19(4)5)21(7)17-20(6)12-2/h12,19-24H,2,11,13-18H2,1,3-10H3 |
| InChIKey | ZLYKWBCWCWWNRO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|