C23H44O5 — CID 142528969
(10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methoxypropanoate (PubChem CID 142528969) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methoxypropanoate.
| Compound Name | (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methoxypropanoate |
|---|---|
| PubChem CID | 142528969 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methoxypropanoate |
| SMILES | C=CC(C)CC(C)C(CCC(C)C(CCCC)(OC)OC)OC(=O)C(C)OC |
| InChI | InChI=1S/C23H44O5/c1-10-12-15-23(26-8,27-9)19(5)13-14-21(18(4)16-17(3)11-2)28-22(24)20(6)25-7/h11,17-21H,2,10,12-16H2,1,3-9H3 |
| InChIKey | ZQJDUGYOKXPGBK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|