C23H44O4 — CID 142528977
(10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methylpropanoate (PubChem CID 142528977) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methylpropanoate.
| Compound Name | (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 142528977 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | (10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl) 2-methylpropanoate |
| SMILES | C=CC(C)CC(C)C(CCC(C)C(CCCC)(OC)OC)OC(=O)C(C)C |
| InChI | InChI=1S/C23H44O4/c1-10-12-15-23(25-8,26-9)20(7)13-14-21(27-22(24)17(3)4)19(6)16-18(5)11-2/h11,17-21H,2,10,12-16H2,1,3-9H3 |
| InChIKey | YVGQVKCADPOJCM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|