C22H36O7 — CID 140687757
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-undec-10-en-2-yloxolan-2-yl]methyl acetate (PubChem CID 140687757) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyloxy-5-undec-10-en-2-yloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-undec-10-en-2-yloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 140687757 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-undec-10-en-2-yloxolan-2-yl]methyl acetate |
| SMILES | C=CCCCCCCCC(C)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H36O7/c1-6-7-8-9-10-11-12-13-15(2)20-22(28-18(5)25)21(27-17(4)24)19(29-20)14-26-16(3)23/h6,15,19-22H,1,7-14H2,2-5H3/t15?,19-,20+,21-,22-/m1/s1 |
| InChIKey | WEQYIAMYZZCJFI-DZCMVMFNSA-N |
| XLogP | 3.73 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|