C23H42O4 — CID 162957253
5-dec-9-enyl-3-[2,3-di(propan-2-yloxy)propyl]oxolan-2-one (PubChem CID 162957253) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is 5-dec-9-enyl-3-[2,3-di(propan-2-yloxy)propyl]oxolan-2-one.
| Compound Name | 5-dec-9-enyl-3-[2,3-di(propan-2-yloxy)propyl]oxolan-2-one |
|---|---|
| PubChem CID | 162957253 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 5-dec-9-enyl-3-[2,3-di(propan-2-yloxy)propyl]oxolan-2-one |
| SMILES | C=CCCCCCCCCC1CC(CC(COC(C)C)OC(C)C)C(=O)O1 |
| InChI | InChI=1S/C23H42O4/c1-6-7-8-9-10-11-12-13-14-21-15-20(23(24)27-21)16-22(26-19(4)5)17-25-18(2)3/h6,18-22H,1,7-17H2,2-5H3 |
| InChIKey | WSUJLSJWQGZXKI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|