C13H22O4 — CID 154715742
[(1R)-1-[(2R,3S,5R)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pent-4-enyl] acetate (PubChem CID 154715742) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S,5R)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pent-4-enyl] acetate.
| Compound Name | [(1R)-1-[(2R,3S,5R)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pent-4-enyl] acetate |
|---|---|
| PubChem CID | 154715742 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(1R)-1-[(2R,3S,5R)-5-(hydroxymethyl)-3-methyloxolan-2-yl]pent-4-enyl] acetate |
| SMILES | C=CCC[C@@H](OC(C)=O)[C@@H]1O[C@@H](CO)C[C@@H]1C |
| InChI | InChI=1S/C13H22O4/c1-4-5-6-12(16-10(3)15)13-9(2)7-11(8-14)17-13/h4,9,11-14H,1,5-8H2,2-3H3/t9-,11+,12+,13+/m0/s1 |
| InChIKey | HHCNYAHGVSRHTB-WKSBVSIWSA-N |
| XLogP | 1.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|