C12H20O4 — CID 11961399
[(1R)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]pent-4-enyl] acetate (PubChem CID 11961399) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(1R)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]pent-4-enyl] acetate.
| Compound Name | [(1R)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]pent-4-enyl] acetate |
|---|---|
| PubChem CID | 11961399 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(1R)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]pent-4-enyl] acetate |
| SMILES | C=CCC[C@@H](OC(C)=O)[C@H]1CC[C@H](CO)O1 |
| InChI | InChI=1S/C12H20O4/c1-3-4-5-11(15-9(2)14)12-7-6-10(8-13)16-12/h3,10-13H,1,4-8H2,2H3/t10-,11-,12-/m1/s1 |
| InChIKey | UKTCCMWXFPQESE-IJLUTSLNSA-N |
| XLogP | 1.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|