C19H36O4 — CID 25107527
[(2S,4S)-2,4-dihydroxyheptadec-16-enyl] acetate (PubChem CID 25107527) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is [(2S,4S)-2,4-dihydroxyheptadec-16-enyl] acetate.
| Compound Name | [(2S,4S)-2,4-dihydroxyheptadec-16-enyl] acetate |
|---|---|
| PubChem CID | 25107527 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | [(2S,4S)-2,4-dihydroxyheptadec-16-enyl] acetate |
| SMILES | C=CCCCCCCCCCCC[C@H](O)C[C@H](O)COC(C)=O |
| InChI | InChI=1S/C19H36O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(21)15-19(22)16-23-17(2)20/h3,18-19,21-22H,1,4-16H2,2H3/t18-,19-/m0/s1 |
| InChIKey | NLBYRERHXBTBBR-OALUTQOASA-N |
| XLogP | 4.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|