C13H20O5 — CID 163410452
[(2S,3S,5S)-3-acetyloxy-5-but-3-enyloxolan-2-yl]methyl acetate (PubChem CID 163410452) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(2S,3S,5S)-3-acetyloxy-5-but-3-enyloxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,5S)-3-acetyloxy-5-but-3-enyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163410452 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [(2S,3S,5S)-3-acetyloxy-5-but-3-enyloxolan-2-yl]methyl acetate |
| SMILES | C=CCC[C@H]1C[C@H](OC(C)=O)[C@H](COC(C)=O)O1 |
| InChI | InChI=1S/C13H20O5/c1-4-5-6-11-7-12(17-10(3)15)13(18-11)8-16-9(2)14/h4,11-13H,1,5-8H2,2-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | QELRFHRLEHUODQ-AVGNSLFASA-N |
| XLogP | 1.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|