C11H18O2 — CID 134993637
(3R,6R)-3-ethyl-1,7-dioxaspiro[5.5]undec-10-ene (PubChem CID 134993637) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3R,6R)-3-ethyl-1,7-dioxaspiro[5.5]undec-10-ene.
| Compound Name | (3R,6R)-3-ethyl-1,7-dioxaspiro[5.5]undec-10-ene |
|---|---|
| PubChem CID | 134993637 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3R,6R)-3-ethyl-1,7-dioxaspiro[5.5]undec-10-ene |
| SMILES | CC[C@@H]1CC[C@]2(C=CCCO2)OC1 |
| InChI | InChI=1S/C11H18O2/c1-2-10-5-7-11(13-9-10)6-3-4-8-12-11/h3,6,10H,2,4-5,7-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | VOPNSLXZOGQCTP-MNOVXSKESA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|