C23H37O5- — CID 135046135
(3R,4R)-4-(oxan-2-yloxy)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-olate (PubChem CID 135046135) has the molecular formula C23H37O5- and a molecular weight of 393.54 g/mol. Its IUPAC name is (3R,4R)-4-(oxan-2-yloxy)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-olate.
| Compound Name | (3R,4R)-4-(oxan-2-yloxy)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-olate |
|---|---|
| PubChem CID | 135046135 |
| Molecular Formula | C23H37O5- |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | (3R,4R)-4-(oxan-2-yloxy)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-olate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C=C([O-])C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C23H38O5/c1-2-3-4-9-20(27-22-10-5-7-14-25-22)13-12-18-16-19(24)17-21(18)28-23-11-6-8-15-26-23/h12-13,16,18,20-24H,2-11,14-15,17H2,1H3/p-1/b13-12+/t18-,20+,21-,22?,23?/m1/s1 |
| InChIKey | ULXUYWNUDKYFJR-PEFWWGECSA-M |
| XLogP | 4.21 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|