C20H36O4 — CID 57287518
5-Pent-1-enyl-2-[2-(2-pentyl-1,3-dioxan-5-yl)ethyl]-1,3-dioxane (PubChem CID 57287518) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 5-pent-1-enyl-2-[2-(2-pentyl-1,3-dioxan-5-yl)ethyl]-1,3-dioxane.
| Compound Name | 5-Pent-1-enyl-2-[2-(2-pentyl-1,3-dioxan-5-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 57287518 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 5-pent-1-enyl-2-[2-(2-pentyl-1,3-dioxan-5-yl)ethyl]-1,3-dioxane |
| SMILES | CCCCCC1OCC(CO1)CCC2OCC(CO2)C=CCCC |
| InChI | InChI=1S/C20H36O4/c1-3-5-7-9-17-13-23-20(24-14-17)12-11-18-15-21-19(22-16-18)10-8-6-4-2/h7,9,17-20H,3-6,8,10-16H2,1-2H3 |
| InChIKey | QWVPLHDKQVVLJF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | 329 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|